What is the 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE?

6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is white to light yellow crystal powder, while it's Molecular Formula is C16H17BrO6. white to light yellow crystal powder Used in Pharmaceutical Industry: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [pharmaceutical compound] for [potential therapeutic applications]. Used in Chemical Research: In the field of chemical research, 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE serves as a valuable compound for studying its chemical properties and potential interactions with other molecules. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [chemical research compound] for [studying its properties and interactions]. Used in Analytical Chemistry: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE can be employed as a reference compound in analytical chemistry for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) or mass spectrometry. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [reference compound] for [analytical method development and validation]. Used in Material Science: The unique chemical properties of 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE make it a potential candidate for the development of new materials with specific characteristics, such as optical, electronic, or mechanical properties. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [material science compound] for [development of new materials with specific characteristics]. Used in Environmental Science: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE may be utilized in environmental science for the detection and monitoring of pollutants or as a component in the development of environmental sensors. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as an [environmental science compound] for [pollutant detection and monitoring or sensor development].

What is the CAS number for 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE?

The CAS number of 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is 15548-61-5.

What is the 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE?

6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is white to light yellow crystal powder, while it's Molecular Formula is C16H17BrO6. white to light yellow crystal powder Used in Pharmaceutical Industry: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [pharmaceutical compound] for [potential therapeutic applications]. Used in Chemical Research: In the field of chemical research, 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE serves as a valuable compound for studying its chemical properties and potential interactions with other molecules. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [chemical research compound] for [studying its properties and interactions]. Used in Analytical Chemistry: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE can be employed as a reference compound in analytical chemistry for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) or mass spectrometry. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [reference compound] for [analytical method development and validation]. Used in Material Science: The unique chemical properties of 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE make it a potential candidate for the development of new materials with specific characteristics, such as optical, electronic, or mechanical properties. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [material science compound] for [development of new materials with specific characteristics]. Used in Environmental Science: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE may be utilized in environmental science for the detection and monitoring of pollutants or as a component in the development of environmental sensors. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as an [environmental science compound] for [pollutant detection and monitoring or sensor development].

What is the CAS number for 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE?

The CAS number of 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is 15548-61-5.

Your location：Home > Others >6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE

6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE

Q: What is 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE (15548-61-5) used for?

6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is a beta-D-glucoside that consists of beta-D-glucopyranose, where the anomeric hydroxy hydrogen is replaced by a 6-bromo-2-naphthyl group. It is a white to light yellow crystal powder and is known for its unique chemical properties.InChI:InChI=1/C16H17BrO6/c17-10-3-1-9-6-11(4-2-8(9)5-10)22-16-15(21)14(20)13(19)12(7-18)23-16/h1-6,12-16,18-21H,7H2/t12-,13+,14+,15-,16-/m0/s1

Basic Information

CAS No.: 15548-61-5

Physical properties

Product Description

Quality Factory Sells Top Purity 99% 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE 15548-61-5 with Safe Delivery

Molecular Formula: C16H17BrO6
Molecular Weight: 385.211
Appearance/Colour: white to light yellow crystal powder
Vapor Pressure: 1.15E-15mmHg at 25°C
Melting Point: 210-212 °C
Refractive Index: 1.698
Boiling Point: 608.6 °C at 760 mmHg
Flash Point: 321.9 °C
PSA： 99.38000
Density: 1.698 g/cm³
LogP: 0.78100